C10H6ClF4NO2 — CID 135051238
N-[2-(2-chloroacetyl)-3-fluorophenyl]-2,2,2-trifluoroacetamide (PubChem CID 135051238) has the molecular formula C10H6ClF4NO2 and a molecular weight of 283.61 g/mol. Its IUPAC name is N-[2-(2-chloroacetyl)-3-fluorophenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(2-chloroacetyl)-3-fluorophenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 135051238 |
| Molecular Formula | C10H6ClF4NO2 |
| Molecular Weight | 283.61 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | N-[2-(2-chloroacetyl)-3-fluorophenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(CCl)c1c(F)cccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H6ClF4NO2/c11-4-7(17)8-5(12)2-1-3-6(8)16-9(18)10(13,14)15/h1-3H,4H2,(H,16,18) |
| InChIKey | XZEWGAHUWNHDCO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|