C15H17IN2O4 — CID 135051591
3-(2-iodo-4-methoxy-6-nitroanilino)-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 135051591) has the molecular formula C15H17IN2O4 and a molecular weight of 416.22 g/mol. Its IUPAC name is 3-(2-iodo-4-methoxy-6-nitroanilino)-5,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 3-(2-iodo-4-methoxy-6-nitroanilino)-5,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135051591 |
| Molecular Formula | C15H17IN2O4 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 3-(2-iodo-4-methoxy-6-nitroanilino)-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | COc1cc(I)c(NC2=CC(=O)CC(C)(C)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H17IN2O4/c1-15(2)7-9(4-10(19)8-15)17-14-12(16)5-11(22-3)6-13(14)18(20)21/h4-6,17H,7-8H2,1-3H3 |
| InChIKey | SGKBGMNCQXYBGA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|