C16H14ClNO6S — CID 135053246
2-[4-(benzenesulfonylmethyl)-2-chloro-5-nitrophenyl]-1,3-dioxolane (PubChem CID 135053246) has the molecular formula C16H14ClNO6S and a molecular weight of 383.81 g/mol. Its IUPAC name is 2-[4-(benzenesulfonylmethyl)-2-chloro-5-nitrophenyl]-1,3-dioxolane.
| Compound Name | 2-[4-(benzenesulfonylmethyl)-2-chloro-5-nitrophenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 135053246 |
| Molecular Formula | C16H14ClNO6S |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 2-[4-(benzenesulfonylmethyl)-2-chloro-5-nitrophenyl]-1,3-dioxolane |
| SMILES | O=[N+]([O-])c1cc(C2OCCO2)c(Cl)cc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H14ClNO6S/c17-14-8-11(10-25(21,22)12-4-2-1-3-5-12)15(18(19)20)9-13(14)16-23-6-7-24-16/h1-5,8-9,16H,6-7,10H2 |
| InChIKey | VJDJPNUPHIFYTF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|