C16H20O4 — CID 135054570
ethyl (4S)-4-ethenyl-2-hydroxy-4-methyl-2-phenyloxolane-3-carboxylate (PubChem CID 135054570) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is ethyl (4S)-4-ethenyl-2-hydroxy-4-methyl-2-phenyloxolane-3-carboxylate.
| Compound Name | ethyl (4S)-4-ethenyl-2-hydroxy-4-methyl-2-phenyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 135054570 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | ethyl (4S)-4-ethenyl-2-hydroxy-4-methyl-2-phenyloxolane-3-carboxylate |
| SMILES | C=C[C@]1(C)COC(O)(c2ccccc2)C1C(=O)OCC |
| InChI | InChI=1S/C16H20O4/c1-4-15(3)11-20-16(18,12-9-7-6-8-10-12)13(15)14(17)19-5-2/h4,6-10,13,18H,1,5,11H2,2-3H3/t13?,15-,16?/m1/s1 |
| InChIKey | FFUBRJAKLWEABZ-OGVSOVDVSA-N |
| XLogP | 2.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|