C27H29NO3S — CID 135056153
4-methyl-N-(1-phenylmethoxybut-3-en-2-yl)-N-[(1R)-1-phenylprop-2-enyl]benzenesulfonamide (PubChem CID 135056153) has the molecular formula C27H29NO3S and a molecular weight of 447.60 g/mol. Its IUPAC name is 4-methyl-N-(1-phenylmethoxybut-3-en-2-yl)-N-[(1R)-1-phenylprop-2-enyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-(1-phenylmethoxybut-3-en-2-yl)-N-[(1R)-1-phenylprop-2-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135056153 |
| Molecular Formula | C27H29NO3S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 4-methyl-N-(1-phenylmethoxybut-3-en-2-yl)-N-[(1R)-1-phenylprop-2-enyl]benzenesulfonamide |
| SMILES | C=CC(COCc1ccccc1)N([C@H](C=C)c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H29NO3S/c1-4-25(21-31-20-23-12-8-6-9-13-23)28(27(5-2)24-14-10-7-11-15-24)32(29,30)26-18-16-22(3)17-19-26/h4-19,25,27H,1-2,20-21H2,3H3/t25?,27-/m1/s1 |
| InChIKey | KRRFRBPGQMXVIG-ZCJYOONXSA-N |
| XLogP | 5.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|