C15H25NO — CID 135056567
(2E)-N-tert-butyl-4-cyclohexylpenta-2,4-dienamide (PubChem CID 135056567) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (2E)-N-tert-butyl-4-cyclohexylpenta-2,4-dienamide.
| Compound Name | (2E)-N-tert-butyl-4-cyclohexylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 135056567 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (2E)-N-tert-butyl-4-cyclohexylpenta-2,4-dienamide |
| SMILES | C=C(/C=C/C(=O)NC(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C15H25NO/c1-12(13-8-6-5-7-9-13)10-11-14(17)16-15(2,3)4/h10-11,13H,1,5-9H2,2-4H3,(H,16,17)/b11-10+ |
| InChIKey | NZMGNVHIXNYGLD-ZHACJKMWSA-N |
| XLogP | 3.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|