C16H27N — CID 135056911
(6R)-6-cyclohexyl-4-methyl-6-(2-methylprop-2-enyl)-2,5-dihydro-1H-pyridine (PubChem CID 135056911) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is (6R)-6-cyclohexyl-4-methyl-6-(2-methylprop-2-enyl)-2,5-dihydro-1H-pyridine.
| Compound Name | (6R)-6-cyclohexyl-4-methyl-6-(2-methylprop-2-enyl)-2,5-dihydro-1H-pyridine |
|---|---|
| PubChem CID | 135056911 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (6R)-6-cyclohexyl-4-methyl-6-(2-methylprop-2-enyl)-2,5-dihydro-1H-pyridine |
| SMILES | C=C(C)C[C@]1(C2CCCCC2)CC(C)=CCN1 |
| InChI | InChI=1S/C16H27N/c1-13(2)11-16(12-14(3)9-10-17-16)15-7-5-4-6-8-15/h9,15,17H,1,4-8,10-12H2,2-3H3/t16-/m1/s1 |
| InChIKey | RALADBOHYBVQNP-MRXNPFEDSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|