C20H20Cl3NO2 — CID 135058188
[(1R)-2,2,2-trichloro-1-phenylethyl] N-[(E,2R)-4-(4-methylphenyl)but-3-en-2-yl]carbamate (PubChem CID 135058188) has the molecular formula C20H20Cl3NO2 and a molecular weight of 412.74 g/mol. Its IUPAC name is [(1R)-2,2,2-trichloro-1-phenylethyl] N-[(E,2R)-4-(4-methylphenyl)but-3-en-2-yl]carbamate.
| Compound Name | [(1R)-2,2,2-trichloro-1-phenylethyl] N-[(E,2R)-4-(4-methylphenyl)but-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 135058188 |
| Molecular Formula | C20H20Cl3NO2 |
| Molecular Weight | 412.74 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | [(1R)-2,2,2-trichloro-1-phenylethyl] N-[(E,2R)-4-(4-methylphenyl)but-3-en-2-yl]carbamate |
| SMILES | Cc1ccc(/C=C/[C@@H](C)NC(=O)O[C@H](c2ccccc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C20H20Cl3NO2/c1-14-8-11-16(12-9-14)13-10-15(2)24-19(25)26-18(20(21,22)23)17-6-4-3-5-7-17/h3-13,15,18H,1-2H3,(H,24,25)/b13-10+/t15-,18-/m1/s1 |
| InChIKey | SCLKXSJOSVJQHV-RBXFWNBASA-N |
| XLogP | 6.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.74 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|