C20H22ClNO5S — CID 135062047
ethyl (2R,3R)-3-chloro-4-(4-methylphenyl)-2-[(4-methylphenyl)sulfonylamino]-4-oxobutanoate (PubChem CID 135062047) has the molecular formula C20H22ClNO5S and a molecular weight of 423.92 g/mol. Its IUPAC name is ethyl (2R,3R)-3-chloro-4-(4-methylphenyl)-2-[(4-methylphenyl)sulfonylamino]-4-oxobutanoate.
| Compound Name | ethyl (2R,3R)-3-chloro-4-(4-methylphenyl)-2-[(4-methylphenyl)sulfonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 135062047 |
| Molecular Formula | C20H22ClNO5S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | ethyl (2R,3R)-3-chloro-4-(4-methylphenyl)-2-[(4-methylphenyl)sulfonylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)[C@@H](NS(=O)(=O)c1ccc(C)cc1)[C@@H](Cl)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H22ClNO5S/c1-4-27-20(24)18(17(21)19(23)15-9-5-13(2)6-10-15)22-28(25,26)16-11-7-14(3)8-12-16/h5-12,17-18,22H,4H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | YQNCGRAAOQULQI-MSOLQXFVSA-N |
| XLogP | 3.00 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|