C20H23NO5S2 — CID 134936455
ethyl (2S)-2-[(2,6-dimethylphenyl)sulfonylsulfanylamino]-4-oxo-4-phenylbutanoate (PubChem CID 134936455) has the molecular formula C20H23NO5S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is ethyl (2S)-2-[(2,6-dimethylphenyl)sulfonylsulfanylamino]-4-oxo-4-phenylbutanoate.
| Compound Name | ethyl (2S)-2-[(2,6-dimethylphenyl)sulfonylsulfanylamino]-4-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 134936455 |
| Molecular Formula | C20H23NO5S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | ethyl (2S)-2-[(2,6-dimethylphenyl)sulfonylsulfanylamino]-4-oxo-4-phenylbutanoate |
| SMILES | CCOC(=O)[C@H](CC(=O)c1ccccc1)NSS(=O)(=O)c1c(C)cccc1C |
| InChI | InChI=1S/C20H23NO5S2/c1-4-26-20(23)17(13-18(22)16-11-6-5-7-12-16)21-27-28(24,25)19-14(2)9-8-10-15(19)3/h5-12,17,21H,4,13H2,1-3H3/t17-/m0/s1 |
| InChIKey | ZSXKLONGICIJNN-KRWDZBQOSA-N |
| XLogP | 3.43 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|