C17H27NO5S2Si — CID 134936456
ethyl (2S)-4-oxo-4-phenyl-2-(2-trimethylsilylethylsulfonylsulfanylamino)butanoate (PubChem CID 134936456) has the molecular formula C17H27NO5S2Si and a molecular weight of 417.63 g/mol. Its IUPAC name is ethyl (2S)-4-oxo-4-phenyl-2-(2-trimethylsilylethylsulfonylsulfanylamino)butanoate.
| Compound Name | ethyl (2S)-4-oxo-4-phenyl-2-(2-trimethylsilylethylsulfonylsulfanylamino)butanoate |
|---|---|
| PubChem CID | 134936456 |
| Molecular Formula | C17H27NO5S2Si |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | ethyl (2S)-4-oxo-4-phenyl-2-(2-trimethylsilylethylsulfonylsulfanylamino)butanoate |
| SMILES | CCOC(=O)[C@H](CC(=O)c1ccccc1)NSS(=O)(=O)CC[Si](C)(C)C |
| InChI | InChI=1S/C17H27NO5S2Si/c1-5-23-17(20)15(13-16(19)14-9-7-6-8-10-14)18-24-25(21,22)11-12-26(2,3)4/h6-10,15,18H,5,11-13H2,1-4H3/t15-/m0/s1 |
| InChIKey | YKUZVUKSVZGMRL-HNNXBMFYSA-N |
| XLogP | 3.10 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|