C17H24FNO4S — CID 102488268
propan-2-yl (2R)-2-(tert-butylsulfinylamino)-4-(4-fluorophenyl)-4-oxobutanoate (PubChem CID 102488268) has the molecular formula C17H24FNO4S and a molecular weight of 357.45 g/mol. Its IUPAC name is propan-2-yl (2R)-2-(tert-butylsulfinylamino)-4-(4-fluorophenyl)-4-oxobutanoate.
| Compound Name | propan-2-yl (2R)-2-(tert-butylsulfinylamino)-4-(4-fluorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 102488268 |
| Molecular Formula | C17H24FNO4S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | propan-2-yl (2R)-2-(tert-butylsulfinylamino)-4-(4-fluorophenyl)-4-oxobutanoate |
| SMILES | CC(C)OC(=O)[C@@H](CC(=O)c1ccc(F)cc1)NS(=O)C(C)(C)C |
| InChI | InChI=1S/C17H24FNO4S/c1-11(2)23-16(21)14(19-24(22)17(3,4)5)10-15(20)12-6-8-13(18)9-7-12/h6-9,11,14,19H,10H2,1-5H3/t14-,24?/m1/s1 |
| InChIKey | LRAQAMPUFGRMBH-GMBBYQRISA-N |
| XLogP | 2.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |