C18H18ClNO5S — CID 135061567
methyl (2R,3R)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-phenylbutanoate (PubChem CID 135061567) has the molecular formula C18H18ClNO5S and a molecular weight of 395.86 g/mol. Its IUPAC name is methyl (2R,3R)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-phenylbutanoate.
| Compound Name | methyl (2R,3R)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 135061567 |
| Molecular Formula | C18H18ClNO5S |
| Molecular Weight | 395.86 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | methyl (2R,3R)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-phenylbutanoate |
| SMILES | COC(=O)[C@@H](NS(=O)(=O)c1ccc(C)cc1)[C@@H](Cl)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18ClNO5S/c1-12-8-10-14(11-9-12)26(23,24)20-16(18(22)25-2)15(19)17(21)13-6-4-3-5-7-13/h3-11,15-16,20H,1-2H3/t15-,16+/m1/s1 |
| InChIKey | QVVUYWSTTLMJPF-CVEARBPZSA-N |
| XLogP | 2.31 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.86 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|