C20H25FO6 — CID 135062672
(1S,2R,6R,8R,9S)-8-[[(E)-2-(4-fluorophenyl)ethenoxy]methyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 135062672) has the molecular formula C20H25FO6 and a molecular weight of 380.41 g/mol. Its IUPAC name is (1S,2R,6R,8R,9S)-8-[[(E)-2-(4-fluorophenyl)ethenoxy]methyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8R,9S)-8-[[(E)-2-(4-fluorophenyl)ethenoxy]methyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 135062672 |
| Molecular Formula | C20H25FO6 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (1S,2R,6R,8R,9S)-8-[[(E)-2-(4-fluorophenyl)ethenoxy]methyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](CO/C=C/c1ccc(F)cc1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C20H25FO6/c1-19(2)24-15-14(11-22-10-9-12-5-7-13(21)8-6-12)23-18-17(16(15)25-19)26-20(3,4)27-18/h5-10,14-18H,11H2,1-4H3/b10-9+/t14-,15+,16+,17-,18-/m1/s1 |
| InChIKey | HGOUCKAQFMHVLQ-JWMFYKTGSA-N |
| XLogP | 3.21 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|