C23H33NO6 — CID 135063082
(E)-4-[benzyl(methyl)amino]-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxybut-2-enal (PubChem CID 135063082) has the molecular formula C23H33NO6 and a molecular weight of 419.52 g/mol. Its IUPAC name is (E)-4-[benzyl(methyl)amino]-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxybut-2-enal.
| Compound Name | (E)-4-[benzyl(methyl)amino]-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxybut-2-enal |
|---|---|
| PubChem CID | 135063082 |
| Molecular Formula | C23H33NO6 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | (E)-4-[benzyl(methyl)amino]-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxybut-2-enal |
| SMILES | CO/C(=C/C=O)C([C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C23H33NO6/c1-22(2)27-15-18(28-22)20-21(30-23(3,4)29-20)19(17(26-6)12-13-25)24(5)14-16-10-8-7-9-11-16/h7-13,18-21H,14-15H2,1-6H3/b17-12+/t18-,19?,20-,21-/m1/s1 |
| InChIKey | IKCJHQMTTWUBGH-MCHLFJTPSA-N |
| XLogP | 2.89 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|