C12H22OSi — CID 135063199
7-[(E)-but-2-en-2-yl]-3,3,6-trimethyl-4,7-dihydro-2H-1,3-oxasilepine (PubChem CID 135063199) has the molecular formula C12H22OSi and a molecular weight of 210.39 g/mol. Its IUPAC name is 7-[(E)-but-2-en-2-yl]-3,3,6-trimethyl-4,7-dihydro-2H-1,3-oxasilepine.
| Compound Name | 7-[(E)-but-2-en-2-yl]-3,3,6-trimethyl-4,7-dihydro-2H-1,3-oxasilepine |
|---|---|
| PubChem CID | 135063199 |
| Molecular Formula | C12H22OSi |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 7-[(E)-but-2-en-2-yl]-3,3,6-trimethyl-4,7-dihydro-2H-1,3-oxasilepine |
| SMILES | C/C=C(\C)C1OC[Si](C)(C)CC=C1C |
| InChI | InChI=1S/C12H22OSi/c1-6-10(2)12-11(3)7-8-14(4,5)9-13-12/h6-7,12H,8-9H2,1-5H3/b10-6+ |
| InChIKey | BPDTXVGUGRYJKJ-UXBLZVDNSA-N |
| XLogP | 3.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|