C31H38NO4P — CID 135064741
ethyl (3R)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(triphenyl-λ5-phosphanylidene)pentanoate (PubChem CID 135064741) has the molecular formula C31H38NO4P and a molecular weight of 519.62 g/mol. Its IUPAC name is ethyl (3R)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(triphenyl-λ5-phosphanylidene)pentanoate.
| Compound Name | ethyl (3R)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(triphenyl-λ5-phosphanylidene)pentanoate |
|---|---|
| PubChem CID | 135064741 |
| Molecular Formula | C31H38NO4P |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | ethyl (3R)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(triphenyl-λ5-phosphanylidene)pentanoate |
| SMILES | CCOC(=O)C([C@H](NC(=O)OC(C)(C)C)C(C)C)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H38NO4P/c1-7-35-29(33)28(27(23(2)3)32-30(34)36-31(4,5)6)37(24-17-11-8-12-18-24,25-19-13-9-14-20-25)26-21-15-10-16-22-26/h8-23,27H,7H2,1-6H3,(H,32,34)/t27-/m1/s1 |
| InChIKey | YPVOYIVEUZQTCD-HHHXNRCGSA-N |
| XLogP | 5.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|