C29H35NO4P+ — CID 166771667
3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxy]propyl-triphenylphosphanium (PubChem CID 166771667) has the molecular formula C29H35NO4P+ and a molecular weight of 492.58 g/mol. Its IUPAC name is 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxy]propyl-triphenylphosphanium.
| Compound Name | 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxy]propyl-triphenylphosphanium |
|---|---|
| PubChem CID | 166771667 |
| Molecular Formula | C29H35NO4P+ |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxy]propyl-triphenylphosphanium |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)OCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H34NO4P/c1-29(2,3)34-28(32)30-21-20-27(31)33-22-13-23-35(24-14-7-4-8-15-24,25-16-9-5-10-17-25)26-18-11-6-12-19-26/h4-12,14-19H,13,20-23H2,1-3H3/p+1 |
| InChIKey | VONMREZJRVADDX-UHFFFAOYSA-O |
| XLogP | 4.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|