C31H39INO4P — CID 140682414
tert-butyl (3S)-4-[iodo(triphenyl)-λ5-phosphanyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 140682414) has the molecular formula C31H39INO4P and a molecular weight of 647.53 g/mol. Its IUPAC name is tert-butyl (3S)-4-[iodo(triphenyl)-λ5-phosphanyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | tert-butyl (3S)-4-[iodo(triphenyl)-λ5-phosphanyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 140682414 |
| Molecular Formula | C31H39INO4P |
| Molecular Weight | 647.53 g/mol |
| Exact Mass | 647.17 |
| IUPAC Name | tert-butyl (3S)-4-[iodo(triphenyl)-λ5-phosphanyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](CP(I)(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H39INO4P/c1-30(2,3)36-28(34)22-24(33-29(35)37-31(4,5)6)23-38(32,25-16-10-7-11-17-25,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-21,24H,22-23H2,1-6H3,(H,33,35)/t24-/m0/s1 |
| InChIKey | WDHIEIJNLLDODZ-DEOSSOPVSA-N |
| XLogP | 6.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.53 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|