C25H26O6S2 — CID 135066349
(4R,5R)-4,5-bis[1-(benzenesulfonyl)propa-1,2-dienyl]-2,2-diethyl-1,3-dioxolane (PubChem CID 135066349) has the molecular formula C25H26O6S2 and a molecular weight of 486.61 g/mol. Its IUPAC name is (4R,5R)-4,5-bis[1-(benzenesulfonyl)propa-1,2-dienyl]-2,2-diethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4,5-bis[1-(benzenesulfonyl)propa-1,2-dienyl]-2,2-diethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 135066349 |
| Molecular Formula | C25H26O6S2 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | (4R,5R)-4,5-bis[1-(benzenesulfonyl)propa-1,2-dienyl]-2,2-diethyl-1,3-dioxolane |
| SMILES | C=C=C([C@@H]1OC(CC)(CC)O[C@H]1C(=C=C)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H26O6S2/c1-5-21(32(26,27)19-15-11-9-12-16-19)23-24(31-25(7-3,8-4)30-23)22(6-2)33(28,29)20-17-13-10-14-18-20/h9-18,23-24H,1-2,7-8H2,3-4H3/t23-,24-/m0/s1 |
| InChIKey | DIOFOVCSFHHAJU-ZEQRLZLVSA-N |
| XLogP | 4.57 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |