C14H22OSi — CID 135066637
5-methyl-2,2-di(propan-2-yl)-3H-1,2-benzoxasilole (PubChem CID 135066637) has the molecular formula C14H22OSi and a molecular weight of 234.41 g/mol. Its IUPAC name is 5-methyl-2,2-di(propan-2-yl)-3H-1,2-benzoxasilole.
| Compound Name | 5-methyl-2,2-di(propan-2-yl)-3H-1,2-benzoxasilole |
|---|---|
| PubChem CID | 135066637 |
| Molecular Formula | C14H22OSi |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 5-methyl-2,2-di(propan-2-yl)-3H-1,2-benzoxasilole |
| SMILES | Cc1ccc2c(c1)C[Si](C(C)C)(C(C)C)O2 |
| InChI | InChI=1S/C14H22OSi/c1-10(2)16(11(3)4)9-13-8-12(5)6-7-14(13)15-16/h6-8,10-11H,9H2,1-5H3 |
| InChIKey | WUCDAZHSFMTFJV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|