C8H9NO — CID 143429247
5-methyl-2,3-dihydro-1,2-benzoxazole (PubChem CID 143429247) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is 5-methyl-2,3-dihydro-1,2-benzoxazole.
| Compound Name | 5-methyl-2,3-dihydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 143429247 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 5-methyl-2,3-dihydro-1,2-benzoxazole |
| SMILES | Cc1ccc2c(c1)CNO2 |
| InChI | InChI=1S/C8H9NO/c1-6-2-3-8-7(4-6)5-9-10-8/h2-4,9H,5H2,1H3 |
| InChIKey | HUICMQRZQIIYHV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |