C22H15Cl2NO — CID 135066812
1-benzyl-5,7-dichloro-2-phenylindole-3-carbaldehyde (PubChem CID 135066812) has the molecular formula C22H15Cl2NO and a molecular weight of 380.27 g/mol. Its IUPAC name is 1-benzyl-5,7-dichloro-2-phenylindole-3-carbaldehyde.
| Compound Name | 1-benzyl-5,7-dichloro-2-phenylindole-3-carbaldehyde |
|---|---|
| PubChem CID | 135066812 |
| Molecular Formula | C22H15Cl2NO |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 1-benzyl-5,7-dichloro-2-phenylindole-3-carbaldehyde |
| SMILES | O=Cc1c(-c2ccccc2)n(Cc2ccccc2)c2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C22H15Cl2NO/c23-17-11-18-19(14-26)21(16-9-5-2-6-10-16)25(22(18)20(24)12-17)13-15-7-3-1-4-8-15/h1-12,14H,13H2 |
| InChIKey | MEFJSRBTHSHILR-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|