C36H28N10 — CID 135067116
2,5-bis[4-(butylamino)phenyl]-3,4-bis(dicyanomethylidene)hexa-1,5-diene-1,1,6,6-tetracarbonitrile (PubChem CID 135067116) has the molecular formula C36H28N10 and a molecular weight of 600.69 g/mol. Its IUPAC name is 2,5-bis[4-(butylamino)phenyl]-3,4-bis(dicyanomethylidene)hexa-1,5-diene-1,1,6,6-tetracarbonitrile.
| Compound Name | 2,5-bis[4-(butylamino)phenyl]-3,4-bis(dicyanomethylidene)hexa-1,5-diene-1,1,6,6-tetracarbonitrile |
|---|---|
| PubChem CID | 135067116 |
| Molecular Formula | C36H28N10 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 2,5-bis[4-(butylamino)phenyl]-3,4-bis(dicyanomethylidene)hexa-1,5-diene-1,1,6,6-tetracarbonitrile |
| SMILES | CCCCNc1ccc(C(=C(C#N)C#N)C(=C(C#N)C#N)C(=C(C#N)C#N)C(=C(C#N)C#N)c2ccc(NCCCC)cc2)cc1 |
| InChI | InChI=1S/C36H28N10/c1-3-5-15-45-31-11-7-25(8-12-31)33(27(17-37)18-38)35(29(21-41)22-42)36(30(23-43)24-44)34(28(19-39)20-40)26-9-13-32(14-10-26)46-16-6-4-2/h7-14,45-46H,3-6,15-16H2,1-2H3 |
| InChIKey | RAWONXVNEBXAKV-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 214.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|