C21H30O2 — CID 135067200
(1S,2R,8R,11R,14R)-2,5-dimethyl-2-(4-methylpent-3-enyl)-12-oxatetracyclo[6.5.1.04,14.011,14]tetradec-4-en-3-one (PubChem CID 135067200) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (1S,2R,8R,11R,14R)-2,5-dimethyl-2-(4-methylpent-3-enyl)-12-oxatetracyclo[6.5.1.04,14.011,14]tetradec-4-en-3-one.
| Compound Name | (1S,2R,8R,11R,14R)-2,5-dimethyl-2-(4-methylpent-3-enyl)-12-oxatetracyclo[6.5.1.04,14.011,14]tetradec-4-en-3-one |
|---|---|
| PubChem CID | 135067200 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (1S,2R,8R,11R,14R)-2,5-dimethyl-2-(4-methylpent-3-enyl)-12-oxatetracyclo[6.5.1.04,14.011,14]tetradec-4-en-3-one |
| SMILES | CC(C)=CCC[C@@]1(C)C(=O)C2=C(C)CC[C@@H]3CC[C@H]4OC[C@H]1[C@@]234 |
| InChI | InChI=1S/C21H30O2/c1-13(2)6-5-11-20(4)16-12-23-17-10-9-15-8-7-14(3)18(19(20)22)21(15,16)17/h6,15-17H,5,7-12H2,1-4H3/t15-,16-,17-,20-,21+/m1/s1 |
| InChIKey | AKAZLOMOBZDDLX-PELSAHOSSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|