C21H30O2 — CID 71614593
(1R,4R,5S,11S,14R)-5,7-dimethyl-5-(4-methylpent-3-enyl)-2-oxatetracyclo[6.5.1.04,14.011,14]tetradec-7-en-9-one (PubChem CID 71614593) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (1R,4R,5S,11S,14R)-5,7-dimethyl-5-(4-methylpent-3-enyl)-2-oxatetracyclo[6.5.1.04,14.011,14]tetradec-7-en-9-one.
| Compound Name | (1R,4R,5S,11S,14R)-5,7-dimethyl-5-(4-methylpent-3-enyl)-2-oxatetracyclo[6.5.1.04,14.011,14]tetradec-7-en-9-one |
|---|---|
| PubChem CID | 71614593 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (1R,4R,5S,11S,14R)-5,7-dimethyl-5-(4-methylpent-3-enyl)-2-oxatetracyclo[6.5.1.04,14.011,14]tetradec-7-en-9-one |
| SMILES | CC(C)=CCC[C@@]1(C)CC(C)=C2C(=O)C[C@@H]3CC[C@H]4OC[C@H]1[C@@]234 |
| InChI | InChI=1S/C21H30O2/c1-13(2)6-5-9-20(4)11-14(3)19-16(22)10-15-7-8-18-21(15,19)17(20)12-23-18/h6,15,17-18H,5,7-12H2,1-4H3/t15-,17+,18+,20-,21-/m0/s1 |
| InChIKey | GVKWJUOXYCOUQA-XEOJFFABSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|