C21H19F2NO2 — CID 135067206
1-acetyl-3-ethyl-6,6-bis(4-fluorophenyl)-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 135067206) has the molecular formula C21H19F2NO2 and a molecular weight of 355.38 g/mol. Its IUPAC name is 1-acetyl-3-ethyl-6,6-bis(4-fluorophenyl)-3-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | 1-acetyl-3-ethyl-6,6-bis(4-fluorophenyl)-3-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 135067206 |
| Molecular Formula | C21H19F2NO2 |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-acetyl-3-ethyl-6,6-bis(4-fluorophenyl)-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | CCN1CC2C(C(C)=O)(C1=O)C2(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H19F2NO2/c1-3-24-12-18-20(13(2)25,19(24)26)21(18,14-4-8-16(22)9-5-14)15-6-10-17(23)11-7-15/h4-11,18H,3,12H2,1-2H3 |
| InChIKey | LJTHFBRXQMCZPM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|