C14H12FN3O4 — CID 91279333
6-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid (PubChem CID 91279333) has the molecular formula C14H12FN3O4 and a molecular weight of 305.26 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid.
| Compound Name | 6-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 91279333 |
| Molecular Formula | C14H12FN3O4 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 6-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid |
| SMILES | O=C(O)N1CC2CC1C1(c3ccc(F)cc3)C(=O)NC(=O)N21 |
| InChI | InChI=1S/C14H12FN3O4/c15-8-3-1-7(2-4-8)14-10-5-9(6-17(10)13(21)22)18(14)12(20)16-11(14)19/h1-4,9-10H,5-6H2,(H,21,22)(H,16,19,20) |
| InChIKey | FJIOQCFLVGVAPL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|