C20H22O2 — CID 135068001
(1R,2S,8R,11R,14R)-5-methyl-2-phenyl-12-oxatetracyclo[6.5.1.04,14.011,14]tetradec-4-en-3-one (PubChem CID 135068001) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (1R,2S,8R,11R,14R)-5-methyl-2-phenyl-12-oxatetracyclo[6.5.1.04,14.011,14]tetradec-4-en-3-one.
| Compound Name | (1R,2S,8R,11R,14R)-5-methyl-2-phenyl-12-oxatetracyclo[6.5.1.04,14.011,14]tetradec-4-en-3-one |
|---|---|
| PubChem CID | 135068001 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (1R,2S,8R,11R,14R)-5-methyl-2-phenyl-12-oxatetracyclo[6.5.1.04,14.011,14]tetradec-4-en-3-one |
| SMILES | CC1=C2C(=O)[C@H](c3ccccc3)[C@H]3CO[C@@H]4CC[C@@H](CC1)[C@]234 |
| InChI | InChI=1S/C20H22O2/c1-12-7-8-14-9-10-16-20(14)15(11-22-16)17(19(21)18(12)20)13-5-3-2-4-6-13/h2-6,14-17H,7-11H2,1H3/t14-,15-,16-,17-,20+/m1/s1 |
| InChIKey | VMVDCPXRTBMMIT-RXFYRGCNSA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |