C21H22O2 — CID 135067664
[(3aR,4S,5S,6aR)-4-methyl-4-phenyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]furan-5-yl]-phenylmethanone (PubChem CID 135067664) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is [(3aR,4S,5S,6aR)-4-methyl-4-phenyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]furan-5-yl]-phenylmethanone.
| Compound Name | [(3aR,4S,5S,6aR)-4-methyl-4-phenyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]furan-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 135067664 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | [(3aR,4S,5S,6aR)-4-methyl-4-phenyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]furan-5-yl]-phenylmethanone |
| SMILES | C[C@@]1(c2ccccc2)[C@@H](C(=O)c2ccccc2)C[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C21H22O2/c1-21(17-10-6-3-7-11-17)18(12-16-13-23-14-19(16)21)20(22)15-8-4-2-5-9-15/h2-11,16,18-19H,12-14H2,1H3/t16-,18+,19+,21+/m0/s1 |
| InChIKey | HKEOWNKPADOMPL-HKJQZYRSSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |