C19H22O3 — CID 58058327
(4R)-5-methyl-4-[(E)-3-oxo-5-phenylpent-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 58058327) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (4R)-5-methyl-4-[(E)-3-oxo-5-phenylpent-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (4R)-5-methyl-4-[(E)-3-oxo-5-phenylpent-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 58058327 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (4R)-5-methyl-4-[(E)-3-oxo-5-phenylpent-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC1CC2OC(=O)CC2[C@H]1/C=C/C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C19H22O3/c1-13-11-18-17(12-19(21)22-18)16(13)10-9-15(20)8-7-14-5-3-2-4-6-14/h2-6,9-10,13,16-18H,7-8,11-12H2,1H3/b10-9+/t13?,16-,17?,18?/m0/s1 |
| InChIKey | KRNDSNPTTMWKKZ-DGDJPTCLSA-N |
| XLogP | 3.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|