C22H24O2 — CID 135069459
[(3aR,4S,5S,6aR)-3a,4-dimethyl-4-phenyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-yl]-phenylmethanone (PubChem CID 135069459) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is [(3aR,4S,5S,6aR)-3a,4-dimethyl-4-phenyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-yl]-phenylmethanone.
| Compound Name | [(3aR,4S,5S,6aR)-3a,4-dimethyl-4-phenyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 135069459 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | [(3aR,4S,5S,6aR)-3a,4-dimethyl-4-phenyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-yl]-phenylmethanone |
| SMILES | C[C@@]12COC[C@@H]1C[C@H](C(=O)c1ccccc1)[C@@]2(C)c1ccccc1 |
| InChI | InChI=1S/C22H24O2/c1-21-15-24-14-18(21)13-19(20(23)16-9-5-3-6-10-16)22(21,2)17-11-7-4-8-12-17/h3-12,18-19H,13-15H2,1-2H3/t18-,19+,21+,22+/m0/s1 |
| InChIKey | IPXRLAHRLHEQEQ-YVNJGZBMSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |