About 2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile
2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile (PubChem CID 135068108) has the molecular formula C9H10N2OS
and a molecular weight of 194.26 g/mol. Its IUPAC name is 2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile.
Molecular Properties
| Compound Name | 2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile |
| PubChem CID | 135068108 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile |
| SMILES | CS(C)(=O)=C(C#N)c1ccccn1 |
| InChI | InChI=1S/C9H10N2OS/c1-13(2,12)9(7-10)8-5-3-4-6-11-8/h3-6H,1-2H3 |
| InChIKey | VDEHEXVZJUHEHH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile?
The IUPAC name of 2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile (CID 135068108) is 2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile.
What is the SMILES notation for 2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile?
The canonical SMILES for 2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile is CS(C)(=O)=C(C#N)c1ccccn1.
What is the InChIKey of 2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile?
The InChIKey is VDEHEXVZJUHEHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2OS/c1-13(2,12)9(7-10)8-5-3-4-6-11-8/h3-6H,1-2H3.
What are the key properties of 2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile?
2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile has a molecular weight of 194.26 g/mol, XLogP of 0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyridin-2-ylacetonitrile is sourced from PubChem (CID 135068108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).