C18H18O3 — CID 135069906
9-(1-hydroxy-2,2-dimethylpropyl)benzo[c]chromen-6-one (PubChem CID 135069906) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 9-(1-hydroxy-2,2-dimethylpropyl)benzo[c]chromen-6-one.
| Compound Name | 9-(1-hydroxy-2,2-dimethylpropyl)benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 135069906 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 9-(1-hydroxy-2,2-dimethylpropyl)benzo[c]chromen-6-one |
| SMILES | CC(C)(C)C(O)c1ccc2c(=O)oc3ccccc3c2c1 |
| InChI | InChI=1S/C18H18O3/c1-18(2,3)16(19)11-8-9-13-14(10-11)12-6-4-5-7-15(12)21-17(13)20/h4-10,16,19H,1-3H3 |
| InChIKey | TYIQRMZVMPONLD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|