About lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide
lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide (PubChem CID 135070565) has the molecular formula C15H21LiS2
and a molecular weight of 272.41 g/mol. Its IUPAC name is lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide.
Molecular Properties
| Compound Name | lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide |
| PubChem CID | 135070565 |
| Molecular Formula | C15H21LiS2 |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide |
| SMILES | CCCCCCCCCc1csc2c[c-]sc12.[Li+] |
| InChI | InChI=1S/C15H21S2.Li/c1-2-3-4-5-6-7-8-9-13-12-17-14-10-11-16-15(13)14;/h10,12H,2-9H2,1H3;/q-1;+1 |
| InChIKey | MSHJHKKDLVUOPX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide?
The IUPAC name of lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide (CID 135070565) is lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide.
What is the SMILES notation for lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide?
The canonical SMILES for lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide is CCCCCCCCCc1csc2c[c-]sc12.[Li+].
What is the InChIKey of lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide?
The InChIKey is MSHJHKKDLVUOPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21S2.Li/c1-2-3-4-5-6-7-8-9-13-12-17-14-10-11-16-15(13)14;/h10,12H,2-9H2,1H3;/q-1;+1.
What are the key properties of lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide?
lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide has a molecular weight of 272.41 g/mol, XLogP of 3.06, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 3-nonyl-5H-thieno[3,2-b]thiophen-5-ide is sourced from PubChem (CID 135070565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).