C15H19N3OS — CID 135070612
(4R,5S)-5-butyl-5-isocyano-4-[(R)-(4-methylphenyl)sulfinyl]-3,4-dihydropyrazole (PubChem CID 135070612) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is (4R,5S)-5-butyl-5-isocyano-4-[(R)-(4-methylphenyl)sulfinyl]-3,4-dihydropyrazole.
| Compound Name | (4R,5S)-5-butyl-5-isocyano-4-[(R)-(4-methylphenyl)sulfinyl]-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 135070612 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (4R,5S)-5-butyl-5-isocyano-4-[(R)-(4-methylphenyl)sulfinyl]-3,4-dihydropyrazole |
| SMILES | [C-]#[N+][C@@]1(CCCC)N=NC[C@H]1[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H19N3OS/c1-4-5-10-15(16-3)14(11-17-18-15)20(19)13-8-6-12(2)7-9-13/h6-9,14H,4-5,10-11H2,1-2H3/t14-,15+,20+/m1/s1 |
| InChIKey | ZIWCKLQEINJBPI-SIFCLUCFSA-N |
| XLogP | 3.74 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|