C35H54O6Si — CID 135071680
[(Z,2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-prop-2-enoxyhex-4-en-2-yl] (2E,4Z,8E)-10-[(2S,6S)-6-ethenyl-4-methylideneoxan-2-yl]-5-methyl-7-oxodeca-2,4,8-trienoate (PubChem CID 135071680) has the molecular formula C35H54O6Si and a molecular weight of 598.90 g/mol. Its IUPAC name is [(Z,2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-prop-2-enoxyhex-4-en-2-yl] (2E,4Z,8E)-10-[(2S,6S)-6-ethenyl-4-methylideneoxan-2-yl]-5-methyl-7-oxodeca-2,4,8-trienoate.
| Compound Name | [(Z,2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-prop-2-enoxyhex-4-en-2-yl] (2E,4Z,8E)-10-[(2S,6S)-6-ethenyl-4-methylideneoxan-2-yl]-5-methyl-7-oxodeca-2,4,8-trienoate |
|---|---|
| PubChem CID | 135071680 |
| Molecular Formula | C35H54O6Si |
| Molecular Weight | 598.90 g/mol |
| Exact Mass | 598.37 |
| IUPAC Name | [(Z,2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-prop-2-enoxyhex-4-en-2-yl] (2E,4Z,8E)-10-[(2S,6S)-6-ethenyl-4-methylideneoxan-2-yl]-5-methyl-7-oxodeca-2,4,8-trienoate |
| SMILES | C=CCOC/C=C(/C)C[C@H](CO[Si](C)(C)C(C)(C)C)OC(=O)/C=C/C=C(/C)CC(=O)/C=C/C[C@H]1CC(=C)C[C@@H](C=C)O1 |
| InChI | InChI=1S/C35H54O6Si/c1-11-20-38-21-19-28(4)23-33(26-39-42(9,10)35(6,7)8)41-34(37)18-13-15-27(3)22-30(36)16-14-17-32-25-29(5)24-31(12-2)40-32/h11-16,18-19,31-33H,1-2,5,17,20-26H2,3-4,6-10H3/b16-14+,18-13+,27-15-,28-19-/t31-,32+,33-/m1/s1 |
| InChIKey | SOQZBQBFXOWXQY-CCPSTVJPSA-N |
| XLogP | 8.16 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.90 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|