C27H42INO5SSi — CID 102009069
[(E,2S)-5-iodo-4-methylpent-4-en-2-yl] (E,5S)-5-[2-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enoyloxypropyl]-1,3-thiazol-4-yl]hex-2-enoate (PubChem CID 102009069) has the molecular formula C27H42INO5SSi and a molecular weight of 647.69 g/mol. Its IUPAC name is [(E,2S)-5-iodo-4-methylpent-4-en-2-yl] (E,5S)-5-[2-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enoyloxypropyl]-1,3-thiazol-4-yl]hex-2-enoate.
| Compound Name | [(E,2S)-5-iodo-4-methylpent-4-en-2-yl] (E,5S)-5-[2-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enoyloxypropyl]-1,3-thiazol-4-yl]hex-2-enoate |
|---|---|
| PubChem CID | 102009069 |
| Molecular Formula | C27H42INO5SSi |
| Molecular Weight | 647.69 g/mol |
| Exact Mass | 647.16 |
| IUPAC Name | [(E,2S)-5-iodo-4-methylpent-4-en-2-yl] (E,5S)-5-[2-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enoyloxypropyl]-1,3-thiazol-4-yl]hex-2-enoate |
| SMILES | C=CC(=O)O[C@@H](CO[Si](C)(C)C(C)(C)C)Cc1nc([C@@H](C)C/C=C/C(=O)O[C@@H](C)C/C(C)=C/I)cs1 |
| InChI | InChI=1S/C27H42INO5SSi/c1-10-25(30)34-22(17-32-36(8,9)27(5,6)7)15-24-29-23(18-35-24)20(3)12-11-13-26(31)33-21(4)14-19(2)16-28/h10-11,13,16,18,20-22H,1,12,14-15,17H2,2-9H3/b13-11+,19-16+/t20-,21-,22+/m0/s1 |
| InChIKey | MAKDUSAGXMSPFU-IYAQXVPXSA-N |
| XLogP | 7.52 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.69 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|