C14H18N2O — CID 135072862
(2Z)-2-benzylidene-3-tert-butyl-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 135072862) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is (2Z)-2-benzylidene-3-tert-butyl-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z)-2-benzylidene-3-tert-butyl-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 135072862 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (2Z)-2-benzylidene-3-tert-butyl-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | CC(C)(C)C1CC([O-])=N/[N+]1=C\c1ccccc1 |
| InChI | InChI=1S/C14H18N2O/c1-14(2,3)12-9-13(17)15-16(12)10-11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3/b16-10- |
| InChIKey | GIODOGOFCJBQFG-YBEGLDIGSA-N |
| XLogP | 1.61 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|