About 1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol
1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol (PubChem CID 135075472) has the molecular formula C14H29ClOSi
and a molecular weight of 276.92 g/mol. Its IUPAC name is 1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol.
Molecular Properties
| Compound Name | 1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol |
| PubChem CID | 135075472 |
| Molecular Formula | C14H29ClOSi |
| Molecular Weight | 276.92 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol |
| SMILES | CC(C)=CCCC(C)CC(O)C(Cl)[Si](C)(C)C |
| InChI | InChI=1S/C14H29ClOSi/c1-11(2)8-7-9-12(3)10-13(16)14(15)17(4,5)6/h8,12-14,16H,7,9-10H2,1-6H3 |
| InChIKey | UBLZYNQTJVOMIJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.92 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol?
The IUPAC name of 1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol (CID 135075472) is 1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol.
What is the SMILES notation for 1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol?
The canonical SMILES for 1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol is CC(C)=CCCC(C)CC(O)C(Cl)[Si](C)(C)C.
What is the InChIKey of 1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol?
The InChIKey is UBLZYNQTJVOMIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29ClOSi/c1-11(2)8-7-9-12(3)10-13(16)14(15)17(4,5)6/h8,12-14,16H,7,9-10H2,1-6H3.
What are the key properties of 1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol?
1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol has a molecular weight of 276.92 g/mol, XLogP of 4.60, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4,8-dimethyl-1-trimethylsilylnon-7-en-2-ol is sourced from PubChem (CID 135075472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).