C13H24Cl3N3O5S — CID 135076107
tert-butyl (2S,3R)-2-[[amino-(2,2,2-trichloroethoxysulfonylamino)methylidene]amino]-3-methylpentanoate (PubChem CID 135076107) has the molecular formula C13H24Cl3N3O5S and a molecular weight of 440.78 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-[[amino-(2,2,2-trichloroethoxysulfonylamino)methylidene]amino]-3-methylpentanoate.
| Compound Name | tert-butyl (2S,3R)-2-[[amino-(2,2,2-trichloroethoxysulfonylamino)methylidene]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 135076107 |
| Molecular Formula | C13H24Cl3N3O5S |
| Molecular Weight | 440.78 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | tert-butyl (2S,3R)-2-[[amino-(2,2,2-trichloroethoxysulfonylamino)methylidene]amino]-3-methylpentanoate |
| SMILES | CC[C@@H](C)[C@H](/N=C(\N)NS(=O)(=O)OCC(Cl)(Cl)Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24Cl3N3O5S/c1-6-8(2)9(10(20)24-12(3,4)5)18-11(17)19-25(21,22)23-7-13(14,15)16/h8-9H,6-7H2,1-5H3,(H3,17,18,19)/t8-,9+/m1/s1 |
| InChIKey | ZWNMCXQYQYHFTF-BDAKNGLRSA-N |
| XLogP | 2.28 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.78 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|