C18H26BrNO2 — CID 135076112
tert-butyl N-[(2-bromophenyl)methyl]-N-[(Z,3S)-hex-4-en-3-yl]carbamate (PubChem CID 135076112) has the molecular formula C18H26BrNO2 and a molecular weight of 368.32 g/mol. Its IUPAC name is tert-butyl N-[(2-bromophenyl)methyl]-N-[(Z,3S)-hex-4-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2-bromophenyl)methyl]-N-[(Z,3S)-hex-4-en-3-yl]carbamate |
|---|---|
| PubChem CID | 135076112 |
| Molecular Formula | C18H26BrNO2 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | tert-butyl N-[(2-bromophenyl)methyl]-N-[(Z,3S)-hex-4-en-3-yl]carbamate |
| SMILES | C/C=C\[C@H](CC)N(Cc1ccccc1Br)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26BrNO2/c1-6-10-15(7-2)20(17(21)22-18(3,4)5)13-14-11-8-9-12-16(14)19/h6,8-12,15H,7,13H2,1-5H3/b10-6-/t15-/m0/s1 |
| InChIKey | AKBJPAMYPJYWRD-MLBQELRYSA-N |
| XLogP | 5.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|