C16H24O3 — CID 135076355
tert-butyl [(1S,2R)-1-ethenyl-2-prop-2-ynylcyclohexyl] carbonate (PubChem CID 135076355) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is tert-butyl [(1S,2R)-1-ethenyl-2-prop-2-ynylcyclohexyl] carbonate.
| Compound Name | tert-butyl [(1S,2R)-1-ethenyl-2-prop-2-ynylcyclohexyl] carbonate |
|---|---|
| PubChem CID | 135076355 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | tert-butyl [(1S,2R)-1-ethenyl-2-prop-2-ynylcyclohexyl] carbonate |
| SMILES | C#CC[C@H]1CCCC[C@@]1(C=C)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24O3/c1-6-10-13-11-8-9-12-16(13,7-2)19-14(17)18-15(3,4)5/h1,7,13H,2,8-12H2,3-5H3/t13-,16+/m0/s1 |
| InChIKey | GYVZZSJQNDIDFB-XJKSGUPXSA-N |
| XLogP | 4.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|