C29H33NO6 — CID 135077925
1-[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]-N-methylmethanimine oxide (PubChem CID 135077925) has the molecular formula C29H33NO6 and a molecular weight of 491.58 g/mol. Its IUPAC name is 1-[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]-N-methylmethanimine oxide.
| Compound Name | 1-[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]-N-methylmethanimine oxide |
|---|---|
| PubChem CID | 135077925 |
| Molecular Formula | C29H33NO6 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 1-[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]-N-methylmethanimine oxide |
| SMILES | COC1OC(/C=[N+](/C)[O-])C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C29H33NO6/c1-30(31)18-25-26(33-19-22-12-6-3-7-13-22)27(34-20-23-14-8-4-9-15-23)28(29(32-2)36-25)35-21-24-16-10-5-11-17-24/h3-18,25-29H,19-21H2,1-2H3/b30-18- |
| InChIKey | RJPWZCLAWURFOT-YKQZZPSBSA-N |
| XLogP | 4.32 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|