C21H33NO3Si — CID 135078322
(4R)-3-[(Z)-2-(4-tert-butylphenyl)-1-trimethylsilyloxyethenyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 135078322) has the molecular formula C21H33NO3Si and a molecular weight of 375.59 g/mol. Its IUPAC name is (4R)-3-[(Z)-2-(4-tert-butylphenyl)-1-trimethylsilyloxyethenyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(Z)-2-(4-tert-butylphenyl)-1-trimethylsilyloxyethenyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135078322 |
| Molecular Formula | C21H33NO3Si |
| Molecular Weight | 375.59 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (4R)-3-[(Z)-2-(4-tert-butylphenyl)-1-trimethylsilyloxyethenyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@@H]1COC(=O)N1/C(=C/c1ccc(C(C)(C)C)cc1)O[Si](C)(C)C |
| InChI | InChI=1S/C21H33NO3Si/c1-15(2)18-14-24-20(23)22(18)19(25-26(6,7)8)13-16-9-11-17(12-10-16)21(3,4)5/h9-13,15,18H,14H2,1-8H3/b19-13-/t18-/m0/s1 |
| InChIKey | BDJDAAXAUTUSRP-UZNZLNSGSA-N |
| XLogP | 5.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|