C18H27NO3Si — CID 135085945
(4R)-3-[(Z)-2-(4-methylphenyl)-1-trimethylsilyloxyethenyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 135085945) has the molecular formula C18H27NO3Si and a molecular weight of 333.50 g/mol. Its IUPAC name is (4R)-3-[(Z)-2-(4-methylphenyl)-1-trimethylsilyloxyethenyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(Z)-2-(4-methylphenyl)-1-trimethylsilyloxyethenyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135085945 |
| Molecular Formula | C18H27NO3Si |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (4R)-3-[(Z)-2-(4-methylphenyl)-1-trimethylsilyloxyethenyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | Cc1ccc(/C=C(\O[Si](C)(C)C)N2C(=O)OC[C@H]2C(C)C)cc1 |
| InChI | InChI=1S/C18H27NO3Si/c1-13(2)16-12-21-18(20)19(16)17(22-23(4,5)6)11-15-9-7-14(3)8-10-15/h7-11,13,16H,12H2,1-6H3/b17-11-/t16-/m0/s1 |
| InChIKey | VSARVOKQLUAYSN-FDIDWWNZSA-N |
| XLogP | 4.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|