C37H34ClN3 — CID 135078420
2-chloro-4,6-bis(9,9-diethylfluoren-2-yl)-1,3,5-triazine (PubChem CID 135078420) has the molecular formula C37H34ClN3 and a molecular weight of 556.15 g/mol. Its IUPAC name is 2-chloro-4,6-bis(9,9-diethylfluoren-2-yl)-1,3,5-triazine.
| Compound Name | 2-chloro-4,6-bis(9,9-diethylfluoren-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 135078420 |
| Molecular Formula | C37H34ClN3 |
| Molecular Weight | 556.15 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | 2-chloro-4,6-bis(9,9-diethylfluoren-2-yl)-1,3,5-triazine |
| SMILES | CCC1(CC)c2ccccc2-c2ccc(-c3nc(Cl)nc(-c4ccc5c(c4)C(CC)(CC)c4ccccc4-5)n3)cc21 |
| InChI | InChI=1S/C37H34ClN3/c1-5-36(6-2)29-15-11-9-13-25(29)27-19-17-23(21-31(27)36)33-39-34(41-35(38)40-33)24-18-20-28-26-14-10-12-16-30(26)37(7-3,8-4)32(28)22-24/h9-22H,5-8H2,1-4H3 |
| InChIKey | CBMANKIPPXAKFE-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.15 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |