C18H26NOPS — CID 135081796
tert-butyl-oxido-phenyl-sulfanylidene-λ5-phosphane;1-phenylethylazanium (PubChem CID 135081796) has the molecular formula C18H26NOPS and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl-oxido-phenyl-sulfanylidene-λ5-phosphane;1-phenylethylazanium.
| Compound Name | tert-butyl-oxido-phenyl-sulfanylidene-λ5-phosphane;1-phenylethylazanium |
|---|---|
| PubChem CID | 135081796 |
| Molecular Formula | C18H26NOPS |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | tert-butyl-oxido-phenyl-sulfanylidene-λ5-phosphane;1-phenylethylazanium |
| SMILES | CC(C)(C)P([O-])(=S)c1ccccc1.CC([NH3+])c1ccccc1 |
| InChI | InChI=1S/C10H15OPS.C8H11N/c1-10(2,3)12(11,13)9-7-5-4-6-8-9;1-7(9)8-5-3-2-4-6-8/h4-8H,1-3H3,(H,11,13);2-7H,9H2,1H3 |
| InChIKey | CVEWLYIGSPNVOW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|