C20H34O2Si — CID 135082718
ethyl 2-[(1R)-1-[2-tri(propan-2-yl)silylethynyl]cyclopent-2-en-1-yl]acetate (PubChem CID 135082718) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is ethyl 2-[(1R)-1-[2-tri(propan-2-yl)silylethynyl]cyclopent-2-en-1-yl]acetate.
| Compound Name | ethyl 2-[(1R)-1-[2-tri(propan-2-yl)silylethynyl]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 135082718 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | ethyl 2-[(1R)-1-[2-tri(propan-2-yl)silylethynyl]cyclopent-2-en-1-yl]acetate |
| SMILES | CCOC(=O)C[C@@]1(C#C[Si](C(C)C)(C(C)C)C(C)C)C=CCC1 |
| InChI | InChI=1S/C20H34O2Si/c1-8-22-19(21)15-20(11-9-10-12-20)13-14-23(16(2)3,17(4)5)18(6)7/h9,11,16-18H,8,10,12,15H2,1-7H3/t20-/m0/s1 |
| InChIKey | NJFHVNXCADZLNK-FQEVSTJZSA-N |
| XLogP | 5.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|