C21H32O2Si — CID 58461639
ethyl (5S,8E,10E)-5-methyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate (PubChem CID 58461639) has the molecular formula C21H32O2Si and a molecular weight of 344.57 g/mol. Its IUPAC name is ethyl (5S,8E,10E)-5-methyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate.
| Compound Name | ethyl (5S,8E,10E)-5-methyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate |
|---|---|
| PubChem CID | 58461639 |
| Molecular Formula | C21H32O2Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | ethyl (5S,8E,10E)-5-methyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate |
| SMILES | CCOC(=O)CCC[C@H](C)C#C/C=C/C=C/CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C21H32O2Si/c1-6-23-21(22)18-15-17-20(2)16-13-11-9-7-8-10-12-14-19-24(3,4)5/h7-9,11,20H,6,10,12,15,17-18H2,1-5H3/b8-7+,11-9+/t20-/m1/s1 |
| InChIKey | DXJBUPSLZRHKCC-CVWKKNFXSA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|